BIOPEP-UWM: Report
| ID | 9936 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 370.4427 | Monoisotopic mass | 370.2209 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fu Y, Young JF, Rasmussen MK, Dalsgaard TK, Lametsch R, Aluko RE, Therkildsen M. | |
| Title | |
| Angiotensin I–converting enzyme–inhibitory peptides from bovine collagen: insights into inhibitory mechanism and transepithelial transport. Food Res. Int. 89, 373–381, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C(C)C)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C17H30N4O5/c1-9(2)13(18)16(24)19-8-12(22)21-7-5-6-11(21)15(23)20-14(10(3)4)17(25)26/h9-11,13-14H,5-8,18H2,1-4H3,(H,19,24)(H,20,23)(H,25,26)/t11-,13-,14-/m0/s1 InChIKey= WHFDCTYBJCLVAN-UBHSHLNASA-N |
| Database reference: |