BIOPEP-UWM: Report
| ID | 9940 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 629.7012 | Monoisotopic mass | 629.2840 | |
| IC50 : | 27.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Girgih AT, He R, Aluko RE. | |
| Title | |
| Kinetics and molecular docking studies of the inhibitions of angiotensin converting enzyme and renin activities by hemp seed (Cannabis sativa L.) peptides. J. Agric. Food Chem. 62, 4135−4144, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC3=CC=C(C=C3)O)C(=O)N[C@@H](CC4=CC=C(C=C4)O)C(=O)O InChI= 1S/C34H39N5O7/c1-19(2)30(39-31(42)26(35)17-22-18-36-27-6-4-3-5-25(22)27)33(44)37-28(15-20-7-11-23(40)12-8-20)32(43)38-29(34(45)46)16-21-9-13-24(41)14-10-21/h3-14,18-19,26,28-30,36,40-41H,15-17,35H2,1-2H3,(H,37,44)(H,38,43)(H,39,42)(H,45,46)/t26-,28-,29-,30-/m0/s1 InChIKey: PRZWESBMSHMINZ-SYKYGTKKSA-N Antioxidative peptide according to the EROP-Moscow databases |
| Database reference: |
| EROP-Moscow: ID E24210 |