BIOPEP-UWM: Report
| ID | 9944 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 303.3141 | Monoisotopic mass | 303.1538 | |
| IC50 : | 270.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Escudero E, Sentandreu MA, Arihara K, Toldrá F. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory peptides generated from in vitro gastrointestinal digestion of pork meat. J. Agric. Food Chem., 58, 2895-2901, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI= 1S/C11H21N5O5/c12-6(3-4-8(17)18)9(19)16-7(10(20)21)2-1-5-15-11(13)14/h6-7H,1-5,12H2,(H,16,19)(H,17,18)(H,20,21)(H4,13,14,15)/t6-,7-/m0/s1 InChIKey: MPZWMIIOPAPAKE-BQBZGAKWSA-N IC50 according to Lafarga et al. (2016). Food Res Int. 81, 91-99 |
| Database reference: |
| AHTPDB: ID 2708, 4719, 5144, 6115 BioPepDB: ID biopep00188 ChemSpider: ID 7972216 EROP-Moscow: ID E09356 HMDB: ID HMDB0028813 PubChem: CID 9796450 SATPdb: ID satpdb22163 |