BIOPEP-UWM: Report
| ID | 9945 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 374.4347 | Monoisotopic mass | 374.2271 | |
| IC50 : | 170.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lafarga T, Aluko RE, Rai DK, O'Connor P, Hayes M. | |
| Title | |
| Identification of bioactive peptides from a papain hydrolysate of bovine serum albumin and assessment of an antihypertensive effect in spontaneously hypertensive rats. Food Res Int. 81, 91-99, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI= 1S/C15H30N6O5/c1-8(2)6-11(21-12(23)9(16)7-22)13(24)20-10(14(25)26)4-3-5-19-15(17)18/h8-11,22H,3-7,16H2,1-2H3,(H,20,24)(H,21,23)(H,25,26)(H4,17,18,19)/t9-,10-,11-/m0/s1 InChIKey: QYSFWUIXDFJUDW-DCAQKATOSA-N |
| Database reference: |
| ChEBI: ID 158995 EROP-Moscow: ID E24530 PubChem: CID 140059892 |