BIOPEP-UWM: Report
| ID | 9954 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 299.2825 | Monoisotopic mass | 299.1226 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Girgih AT, He R, Malomo SA, Offengenden M, Wu J, Aluko RE. | |
| Title | |
| Structural and functional characterization of hemp seed (Cannabis sativa L.) protein-derived antioxidant and antihypertensive peptides. J. Funct. Foods 6, 384–394. | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)O InChI= 1S/C11H17N5O5/c12-2-9(18)15-8(4-17)10(19)16-7(11(20)21)1-6-3-13-5-14-6/h3,5,7-8,17H,1-2,4,12H2,(H,13,14)(H,15,18)(H,16,19)(H,20,21)/t7-,8-/m0/s1 InChIKey: MKIAPEZXQDILRR-YUMQZZPRSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 9035) |
| Database reference: |
| AHTPDB: ID 1558 BioPepDB: ID biopep00415 BIOPEP-UWM database of bioactive peptides: ID 9035 EROP-Moscow: ID E23556 PubChem CID: 145455685 SATPdb: ID satpdb12942 |