BIOPEP-UWM: Report
| ID | 9961 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1280.4725 | Monoisotopic mass | 1279.7339 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sheng J., Yang X., Chen J., Peng T., Yin X., Liu W., Liang M., Wan J., Yang X. | |
| Title | |
| Antioxidative effects and mechanism study of bioactive peptides from defatted walnut ( Juglans regia L.) meal hydrolysate. J. Agric. Food Chem., 67, 3305-3312, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C55H97N19O16/c1-26(2)22-34(71-48(84)36(24-39(57)76)66-40(77)25-65-44(80)30(16-18-41(78)79)68-50(86)42(58)28(5)6)46(82)67-31(15-17-38(56)75)45(81)73-43(29(7)8)51(87)72-35(23-27(3)4)47(83)69-32(12-9-19-63-54(59)60)52(88)74-21-11-14-37(74)49(85)70-33(53(89)90)13-10-20-64-55(61)62/h26-37,42-43H,9-25,58H2,1-8H3,(H2,56,75)(H2,57,76)(H,65,80)(H,66,77)(H,67,82)(H,68,86)(H,69,83)(H,70,85)(H,71,84)(H,72,87)(H,73,81)(H,78,79)(H,89,90)(H4,59,60,63)(H4,61,62,64)/t30-,31-,32-,33-,34-,35-,36-,37-,42-,43-/m0/s1 InChIKey=SRFYFYMKGOCDMR-CUSFNGMQSA-N |
| Database reference: |
| EROP-Moscow: ID E23689 |