BIOPEP-UWM: Report
| ID | 9962 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1234.2756 | Monoisotopic mass | 1233.5833 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sheng J., Yang X., Chen J., Peng T., Yin X., Liu W., Liang M., Wan J., Yang X. | |
| Title | |
| Antioxidative effects and mechanism study of bioactive peptides from defatted walnut ( Juglans regia L.) meal hydrolysate. J. Agric. Food Chem., 67, 3305-3312, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)O InChI=1S/C50H79N19O18/c1-22(2)15-25(51)42(78)61-23(3)41(77)59-20-40(76)62-31(17-38(56)74)49(85)69-14-4-5-33(69)48(84)67-30(16-24-19-58-21-60-24)47(83)66-28(8-12-36(54)72)45(81)64-26(6-10-34(52)70)43(79)63-27(7-11-35(53)71)44(80)65-29(9-13-37(55)73)46(82)68-32(50(86)87)18-39(57)75/h19,21-23,25-33H,4-18,20,51H2,1-3H3,(H2,52,70)(H2,53,71)(H2,54,72)(H2,55,73)(H2,56,74)(H2,57,75)(H,58,60)(H,59,77)(H,61,78)(H,62,76)(H,63,79)(H,64,81)(H,65,80)(H,66,83)(H,67,84)(H,68,82)(H,86,87)/t23-,25-,26-,27-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=HGRDSOWJIBMMGK-DBTPYNJHSA-N |
| Database reference: |
| EROP-Moscow: ID E23690 |