BIOPEP-UWM: Report
| ID | 9964 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1258.2458 | Monoisotopic mass | 1257.5454 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sheng J., Yang X., Chen J., Peng T., Yin X., Liu W., Liang M., Wan J., Yang X. | |
| Title | |
| Antioxidative effects and mechanism study of bioactive peptides from defatted walnut ( Juglans regia L.) meal hydrolysate. J. Agric. Food Chem., 67, 3305-3312, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C50H79N15O23/c1-19(2)11-27(59-44(81)28(13-33(53)70)58-40(77)24(51)12-23-16-54-18-55-23)43(80)60-30(15-36(75)76)46(83)65-39(22(6)68)49(86)56-25(7-9-32(52)69)42(79)64-38(21(5)67)48(85)57-26(8-10-34(71)72)41(78)62-31(17-66)47(84)61-29(14-35(73)74)45(82)63-37(20(3)4)50(87)88/h16,18-22,24-31,37-39,66-68H,7-15,17,51H2,1-6H3,(H2,52,69)(H2,53,70)(H,54,55)(H,56,86)(H,57,85)(H,58,77)(H,59,81)(H,60,80)(H,61,84)(H,62,78)(H,63,82)(H,64,79)(H,65,83)(H,71,72)(H,73,74)(H,75,76)(H,87,88)/t21-,22-,24+,25+,26+,27+,28+,29+,30+,31+,37+,38+,39+/m1/s1 InChIKey=HMWMDJURFCJKDJ-BECZYYDTSA-N |
| Database reference: |
| EROP-Moscow: ID E23691 |