BIOPEP-UWM: Report
| ID | 9965 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 12 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1313.4083 | Monoisotopic mass | 1312.6278 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sheng J., Yang X., Chen J., Peng T., Yin X., Liu W., Liang M., Wan J., Yang X. | |
| Title | |
| Antioxidative effects and mechanism study of bioactive peptides from defatted walnut ( Juglans regia L.) meal hydrolysate. J. Agric. Food Chem., 67, 3305-3312, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C59H88N14O20/c1-29(2)22-38(53(86)68-37(59(92)93)14-10-11-21-60)71-58(91)49(32(6)74)73-57(90)48(30(3)4)72-56(89)40(24-34-15-17-35(75)18-16-34)69-52(85)36(19-20-46(79)80)67-54(87)39(23-33-12-8-7-9-13-33)65-45(78)28-64-51(84)42(26-47(81)82)70-55(88)41(25-43(62)76)66-44(77)27-63-50(83)31(5)61/h7-9,12-13,15-18,29-32,36-42,48-49,74-75H,10-11,14,19-28,60-61H2,1-6H3,(H2,62,76)(H,63,83)(H,64,84)(H,65,78)(H,66,77)(H,67,87)(H,68,86)(H,69,85)(H,70,88)(H,71,91)(H,72,89)(H,73,90)(H,79,80)(H,81,82)(H,92,93)/t31-,32+,36-,37-,38-,39-,40-,41-,42-,48-,49-/m0/s1 InChIKey=ZPZMRRRYNIPRFO-FXONTPFFSA-N |
| Database reference: |
| EROP-Moscow: ID E23692 |