BIOPEP-UWM: Report
| ID | 9968 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 985.0533 | Monoisotopic mass | 984.5086 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sheng J., Yang X., Chen J., Peng T., Yin X., Liu W., Liang M., Wan J., Yang X. | |
| Title | |
| Antioxidative effects and mechanism study of bioactive peptides from defatted walnut ( Juglans regia L.) meal hydrolysate. J. Agric. Food Chem., 67, 3305-3312, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C39H68N16O14/c1-18(2)16-25(38(68)69)50-31(61)17-49-33(63)21(6-11-27(42)57)53-36(66)23(8-13-29(44)59)55-37(67)24(9-14-30(45)60)54-34(64)20(4-3-15-48-39(46)47)52-35(65)22(7-12-28(43)58)51-32(62)19(40)5-10-26(41)56/h18-25H,3-17,40H2,1-2H3,(H2,41,56)(H2,42,57)(H2,43,58)(H2,44,59)(H2,45,60)(H,49,63)(H,50,61)(H,51,62)(H,52,65)(H,53,66)(H,54,64)(H,55,67)(H,68,69)(H4,46,47,48)/t19-,20-,21-,22-,23-,24-,25-/m0/s1 InChIKey=RHWKFPWGRLSTEO-HUVRVWIJSA-N |
| Database reference: |
| EROP-Moscow: ID E23694 |