BIOPEP-UWM: Report
| ID | 9969 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 13 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1408.5519 | Monoisotopic mass | 1407.7334 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sheng J., Yang X., Chen J., Peng T., Yin X., Liu W., Liang M., Wan J., Yang X. | |
| Title | |
| Antioxidative effects and mechanism study of bioactive peptides from defatted walnut ( Juglans regia L.) meal hydrolysate. J. Agric. Food Chem., 67, 3305-3312, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CC(C)C)C(=O)N(CC(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](C(C)C)C(=O)O)C InChI=1S/C62H103N17O21/c1-27(2)20-38(71-52(89)37(16-19-45(84)85)69-51(88)32(11)63)55(92)70-36(15-18-43(65)82)54(91)75-48(30(7)8)59(96)76-47(29(5)6)58(95)73-40(23-46(86)87)57(94)72-39(22-34-24-66-26-67-34)56(93)74-41(21-28(3)4)61(98)79(13)25-44(83)68-35(14-17-42(64)81)53(90)78-50(33(12)80)60(97)77-49(31(9)10)62(99)100/h24,26-33,35-41,47-50,80H,14-23,25,63H2,1-13H3,(H2,64,81)(H2,65,82)(H,66,67)(H,68,83)(H,69,88)(H,70,92)(H,71,89)(H,72,94)(H,73,95)(H,74,93)(H,75,91)(H,76,96)(H,77,97)(H,78,90)(H,84,85)(H,86,87)(H,99,100)/t32-,33+,35-,36-,37-,38-,39-,40-,41-,47-,48-,49-,50-/m0/s1 InChIKey=KFFFERDARNBKDI-GBRZBIKVSA-N |
| Database reference: |
| EROP-Moscow: ID E23695 |