BIOPEP-UWM: Report
| ID | 1 |
| Name | bitter amino acid |
| sequence |
| Function: | |||
| (Rcaf) 0.04 | |||
| Number of residues | 1 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 174.2004 | Monoisotopic mass | 174.1114 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H., | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids; SMILES: C(=O)([C@H](CCCNC(=N)N)N)O InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 InChiKey: ODKSFYDXXFIFQN-BYPYZUCNSA-N Bitterness suppressing amino acids according to the BIOPEP database of sensory peptides and amino acids (ID 371) |
| Database reference: |
| ACToR: ID 25212-18-4 BIOPEP database of sensory peptides and amino acids: ID 371 BRENDA: Ligand L-arginine CHEBI: ID 16467; ChEMBL: ID CHEMBL1485; ChemSpider: ID 6082; FooDB: ID FDB002257; Human Metabolome Database: ID HMDB00517; KEGG Ligand: ID C0006; MetaCyc: Compound: L-arginine; PubChem: ID 6322 ZINC: ID ZINC01532525 |