BIOPEP-UWM: Report
| ID | 10 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 5 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 459.5357 | Monoisotopic mass | 459.2151 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
BIOPEP database of sensory peptides and amino acids SMILES: c1ccc(cc1)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)N InChI=1S/C27H29N3O4/c28-22(16-19-10-4-1-5-11-19)25(31)29-23(17-20-12-6-2-7-13-20)26(32)30-24(27(33)34)18-21-14-8-3-9-15-21/h1-15,22-24H,16-18,28H2,(H,29,31)(H,30,32)(H,33,34)/t22-,23-,24-/m0/s1 InChIKey: CBENHWCORLVGEQ-HJOGWXRNSA-N Another reference for bitter taste: Upadhyaya J., Pydi S. P., Singh N., Aluko R. E., Chelikani P., 2010, Bitter taste receptor T2R1 is activated by dipeptides and tripeptides. Biochem. Biophys. Res. Commun., 398, 331-335. Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| ACToR: ID 2578-81-6 AHTPDB: ID 4573; 4851; 5487 BitterDB: ID 838 BRENDA: Ligand Phe-Phe-Phe ChEMBL: ID CHEMBL420482 ChemSpider: ID 68256 PubChem: ID 75739 |