BIOPEP-UWM: Report
| ID | 100 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 250 | |||
| Number of residues | 10 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1094.3456 | Monoisotopic mass | 1093.6628 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tamura M., Miyoshi T., Mori N., Kinomura K., Kawaguchi M., Ishibashi N., Okai H. | |
| Title | |
| Mechanism of bitter casting potency of peptides using O-aminoacyl sugars as model compounds. Agric. Biol. Chem., 54, 1401-1409, 1990 | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1CCC[C@@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C54H87N13O11/c1-9-32(7)43(51(75)65-44(33(8)10-2)50(74)63-42(31(5)6)53(77)78)64-48(72)39-23-17-27-67(39)52(76)37(28-34-18-12-11-13-19-34)61-47(71)38-22-16-26-66(38)40(68)29-59-45(69)36(21-15-25-58-54(55)56)60-49(73)41(30(3)4)62-46(70)35-20-14-24-57-35/h11-13,18-19,30-33,35-39,41-44,57H,9-10,14-17,20-29H2,1-8H3,(H,59,69)(H,60,73)(H,61,71)(H,62,70)(H,63,74)(H,64,72)(H,65,75)(H,77,78)(H4,55,56,58)/t32-,33-,35+,36-,37-,38+,39+,41-,42-,43-,44-/m0/s1 InChIKey: KXFYUWNBKFUQTR-JTXWZLBFSA-N |
| Database reference: |