BIOPEP-UWM: Report
| ID | 101 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 67 | |||
| Number of residues | 14 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1460.7996 | Monoisotopic mass | 1459.8888 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tamura M., Miyoshi T., Mori N., Kinomura K., Kawaguchi M., Ishibashi N., Okai H. | |
| Title | |
| Mechanism of bitter casting potency of peptides using O-aminoacyl sugars as model compounds. Agric. Biol. Chem., 54, 1401-1409, 1990 | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1CCC[C@@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C72H117N17O15/c1-13-43(11)58(69(101)86-59(44(12)14-2)68(100)84-57(42(9)10)71(103)104)85-65(97)52-29-22-34-89(52)70(102)49(36-45-23-16-15-17-24-45)81-63(95)50-27-20-32-87(50)53(90)37-77-60(92)47(26-19-31-76-72(73)74)79-66(98)56(41(7)8)83-64(96)51-28-21-33-88(51)54(91)38-78-61(93)48(35-39(3)4)80-67(99)55(40(5)6)82-62(94)46-25-18-30-75-46/h15-17,23-24,39-44,46-52,55-59,75H,13-14,18-22,25-38H2,1-12H3,(H,77,92)(H,78,93)(H,79,98)(H,80,99)(H,81,95)(H,82,94)(H,83,96)(H,84,100)(H,85,97)(H,86,101)(H,103,104)(H4,73,74,76)/t43-,44-,46+,47-,48-,49-,50+,51+,52+,55-,56-,57-,58-,59-/m0/s1 InChIKey: ITRGBKFQNFDBPB-JRMIJDHASA-N |
| Database reference: |