BIOPEP-UWM: Report
| ID | 104 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.3 | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 524.6072 | Monoisotopic mass | 524.2626 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)O)Cc2ccccc2)CCC1)Cc1ccc(cc1)O)C(C)C InChI=1S/C28H36N4O6/c1-17(2)24(29)26(35)30-21(15-19-10-12-20(33)13-11-19)27(36)32-14-6-9-23(32)25(34)31-22(28(37)38)16-18-7-4-3-5-8-18/h3-5,7-8,10-13,17,21-24,33H,6,9,14-16,29H2,1-2H3,(H,30,35)(H,31,34)(H,37,38)/t21-,22-,23-,24-/m0/s1 InChIKey: KAAKYCKPZAFLQQ-ZJZGAYNASA-N |
| Database reference: |