BIOPEP-UWM: Report
| ID | 105 |
| Name | bitter amino acid |
| sequence |
| Function: | |||
| (Rcaf) 0.05 | |||
| Number of residues | 1 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 117.1459 | Monoisotopic mass | 117.0787 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S. | |
| Title | |
| Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: CC(C)[C@H](N)C(O)=O InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1 InChIKey: KZSNJWFQEVHDMF-BYPYZUCNSA-N Reveals also sweet taste according to BIOPEP database of sensory peptides and amino acids Annotated as sweet/bitter Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S., 1988, Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94 |
| Database reference: |
| ACToR: ID 72-18-4 BIOPEP database of sensory peptides and amino acids: ID 257 ChEBI: ID 16414 ChEMBL: ID CHEMBL43068 ChemIDplus: ID 000072184 ChemSpider: ID 6050 FooDB: ID FDB000465 Human Metabolome Database (HMDB): ID HMDB00883 KEGG: Compound C00183 PubChem: ID 6287 ZINC: ID ZINC00895099 |