BIOPEP-UWM: Report
| ID | 107 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.03 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 231.2483 | Monoisotopic mass | 231.1215 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S. | |
| Title | |
| Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C9H17N3O4/c1-5(2)8(9(15)16)12-7(14)4-11-6(13)3-10/h5,8H,3-4,10H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)/t8-/m0/s1 InChIKey: OLPPXYMMIARYAL-QMMMGPOBSA-N Inhibitor of citrulline uptake in yeasts according to the ChEMBL database; the PubChem database Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database Inhibitor of HMG-CoA reductase (EC 1.1.1.34) |
| Database reference: |
| ACToR: ID 20274-89-9 AHTPDB: ID 4576; 4860; 5490 BioPepDB: ID biopep00346 BIOPEP-UWM database of bioactive peptides: ID 9383 ChEMBL: ID CHEMBL1221710 ChemIDplus: ID 020274899 ChemSpider: ID 167967 EPA DSSTox: ID DTXCID8096611 J-GLOBAL: ID 200907069869699373 Nikkaji: ID J149.644A PubChem: ID 193555 SATPdb: ID satpdb17293 SureChEMBL: ID SCHEMBL15756824 ZINC: ID ZINC02165165 |