BIOPEP-UWM: Report
| ID | 108 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.22 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 273.3278 | Monoisotopic mass | 273.1683 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S. | |
| Title | |
| Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C12H23N3O4/c1-6(2)9(14-8(16)5-13)11(17)15-10(7(3)4)12(18)19/h6-7,9-10H,5,13H2,1-4H3,(H,14,16)(H,15,17)(H,18,19)/t9-,10-/m0/s1 InChIkey: KSOBNUBCYHGUKH-UWVGGRQHSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 4577; 4863; 5491 |