BIOPEP-UWM: Report
| ID | 111 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.17 | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 230.3031 | Monoisotopic mass | 230.1625 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S. | |
| Title | |
| Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)[C@H](CC)C)C(C)C InChI=1S/C11H22N2O3/c1-5-7(4)9(11(15)16)13-10(14)8(12)6(2)3/h6-9H,5,12H2,1-4H3,(H,13,14)(H,15,16)/t7-,8-,9-/m0/s1 InChIKey: PNVLWFYAPWAQMU-CIUDSAMLSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP database of bioactive peptides Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 5422; 5436 BIOPEP database of bioactive peptides: ID 8920 ChEBI: ID 75012 ChemSpider: ID 5374098 PubChem: ID 7010531 ZINC: ID ZINC02390958 |