BIOPEP-UWM: Report
| ID | 112 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf)3.33 | |||
| Number of residues | 7 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 775.8882 | Monoisotopic mass | 775.3892 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kanehisa H. | |
| Title | |
| Studies of bitter peptides from casein hydrolysate. VI. Syntheses and bitter taste of BPIc (Val-Tyr-Pro-Phe-Pro-Pro-Gly-Ile-Asn-His) and its analogs and fragments. Bull. Chem. Soc. Jpn., 57, 97-102, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N3[C@H](C(=O)NCC(=O)O)CCC3)CCC2)Cc2ccccc2)CCC1)Cc1ccc(cc1)O)C(C)C InChI=1S/C40H53N7O9/c1-24(2)34(41)37(53)44-29(22-26-14-16-27(48)17-15-26)38(54)45-18-7-12-31(45)36(52)43-28(21-25-9-4-3-5-10-25)39(55)47-20-8-13-32(47)40(56)46-19-6-11-30(46)35(51)42-23-33(49)50/h3-5,9-10,14-17,24,28-32,34,48H,6-8,11-13,18-23,41H2,1-2H3,(H,42,51)(H,43,52)(H,44,53)(H,49,50)/t28-,29-,30-,31-,32-,34-/m0/s1 InChIKey: XXIRZKXHCLCXBI-BHONDUSNSA-N |
| Database reference: |