BIOPEP-UWM: Report
| ID | 113 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 6.67 | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 889.0454 | Monoisotopic mass | 888.4730 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kanehisa H. | |
| Title | |
| Studies of bitter peptides from casein hydrolysate. VI. Syntheses and bitter taste of BPIc (Val-Tyr-Pro-Phe-Pro-Pro-Gly-Ile-Asn-His) and its analogs and fragments. Bull. Chem. Soc. Jpn., 57, 97-102, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N3[C@H](C(=O)NCC(=O)N[C@H](C(=O)O)[C@H](CC)C)CCC3)CCC2)Cc2ccccc2)CCC1)Cc1ccc(cc1)O)C(C)C InChI=1S/C46H64N8O10/c1-5-28(4)39(46(63)64)51-37(56)26-48-40(57)34-14-9-22-53(34)45(62)36-16-11-23-54(36)44(61)32(24-29-12-7-6-8-13-29)49-41(58)35-15-10-21-52(35)43(60)33(50-42(59)38(47)27(2)3)25-30-17-19-31(55)20-18-30/h6-8,12-13,17-20,27-28,32-36,38-39,55H,5,9-11,14-16,21-26,47H2,1-4H3,(H,48,57)(H,49,58)(H,50,59)(H,51,56)(H,63,64)/t28-,32-,33-,34-,35-,36-,38-,39-/m0/s1 InChIKey: KADMFWODAQJXLN-YIUNQBEOSA-N |
| Database reference: |