BIOPEP-UWM: Report
| ID | 116 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.33 | |||
| Number of residues | 10 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1003.1478 | Monoisotopic mass | 1002.5158 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kanehisa H. | |
| Title | |
| Studies of bitter peptides from casein hydrolysate. VI. Syntheses and bitter taste of BPIc (Val-Tyr-Pro-Phe-Pro-Pro-Gly-Ile-Asn-His) and its analogs and fragments. Bull. Chem. Soc. Jpn., 57, 97-102, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N3[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)NCC(=O)O)[C@H](CC)C)CCC3)CCC2)Cc2ccccc2)CCC1)Cc1ccc(cc1)O)C(C)C InChI=1S/C50H70N10O12/c1-5-30(4)43(47(69)54-26-39(62)52-28-41(64)65)57-40(63)27-53-44(66)36-14-9-22-59(36)50(72)38-16-11-23-60(38)49(71)34(24-31-12-7-6-8-13-31)55-45(67)37-15-10-21-58(37)48(70)35(56-46(68)42(51)29(2)3)25-32-17-19-33(61)20-18-32/h6-8,12-13,17-20,29-30,34-38,42-43,61H,5,9-11,14-16,21-28,51H2,1-4H3,(H,52,62)(H,53,66)(H,54,69)(H,55,67)(H,56,68)(H,57,63)(H,64,65)/t30-,34-,35-,36-,37-,38-,42-,43-/m0/s1 InChIKey: AHRQLOIXINQATL-SEWMCFDBSA-N |
| Database reference: |