BIOPEP-UWM: Report
| ID | 117 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 4.35 | |||
| Number of residues | 10 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1060.1594 | Monoisotopic mass | 1059.5122 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kanehisa H. | |
| Title | |
| Studies of bitter peptides from casein hydrolysate. VI. Syntheses and bitter taste of BPIc (Val-Tyr-Pro-Phe-Pro-Pro-Gly-Ile-Asn-His) and its analogs and fragments. Bull. Chem. Soc. Jpn., 57, 97-102, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)NCC(=O)NCC(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc2[nH]cnc2)CC(=O)N)[C@H](CC)C)Cc2ccccc2)CCC1)Cc1ccc(cc1)O)C(C)C InChI=1S/C50H69N13O13/c1-5-28(4)43(48(73)59-34(21-38(51)65)45(70)61-36(50(75)76)20-31-22-53-26-57-31)62-41(68)25-55-39(66)23-54-40(67)24-56-44(69)33(18-29-10-7-6-8-11-29)58-46(71)37-12-9-17-63(37)49(74)35(60-47(72)42(52)27(2)3)19-30-13-15-32(64)16-14-30/h6-8,10-11,13-16,22,26-28,33-37,42-43,64H,5,9,12,17-21,23-25,52H2,1-4H3,(H2,51,65)(H,53,57)(H,54,67)(H,55,66)(H,56,69)(H,58,71)(H,59,73)(H,60,72)(H,61,70)(H,62,68)(H,75,76)/t28-,33-,34-,35-,36-,37-,42-,43-/m0/s1 InChIKey: HSEXWLCCZGSBRL-QDHFDEMESA-N |
| Database reference: |