BIOPEP-UWM: Report
| ID | 118 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 40 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 685.8121 | Monoisotopic mass | 685.3900 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Miyake I., Ishibashi N., Fukui H., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. II. Syntheses of bitter peptide fragments and analogs of BPIa (Arg-Gly-Pro-Pro-Phe-Ile-Val) from casein hydrolysate. Bull. Chem. Soc. Jpn., 56, 1116-1119, 1983 | |
| Year | Source |
| 1983 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)O InChI=1S/C33H51N9O7/c1-3-20(2)27(32(48)49)40-29(45)23(18-21-10-5-4-6-11-21)39-30(46)24-13-8-17-42(24)31(47)25-14-9-16-41(25)26(43)19-38-28(44)22(34)12-7-15-37-33(35)36/h4-6,10-11,20,22-25,27H,3,7-9,12-19,34H2,1-2H3,(H,38,44)(H,39,46)(H,40,45)(H,48,49)(H4,35,36,37)/t20-,22-,23-,24-,25-,27-/m0/s1 InChIKey: RNTDXFFEHIIXDE-OWNCGHDPSA-N |
| Database reference: |