BIOPEP-UWM: Report
| ID | 120 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.3 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 629.7061 | Monoisotopic mass | 629.3276 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Nosho Y., Otagiri K., Okai H., Fukui S. | |
| Title | |
| Bitterness of diastereomers of a hexapeptide (Arg-Arg-Pro-Pro-Phe-Phe) containing D-phenylalanine in place of L-phenylalanine. Agric. Biol. Chem., 50, 1785-1790, 1986 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C29H43N9O7/c30-19(9-4-12-33-29(31)32)25(41)35-17-24(40)37-13-6-11-22(37)27(43)38-14-5-10-21(38)26(42)34-16-23(39)36-20(28(44)45)15-18-7-2-1-3-8-18/h1-3,7-8,19-22H,4-6,9-17,30H2,(H,34,42)(H,35,41)(H,36,39)(H,44,45)(H4,31,32,33)/t19-,20-,21-,22-/m0/s1 InChIKey: JIGZNGXRQOGVKV-CMOCDZPBSA-N |
| Database reference: |