BIOPEP-UWM: Report
| ID | 121 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.67 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 261.2313 | Monoisotopic mass | 261.0957 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ohyama S., Ishibashi N., Tamura M., Nishizaki H., Okai H. | |
| Title | |
| Synthesis of bitter peptides composed of aspartic acid and glutamic acid. Agric. Biol. Chem., 52, 871-872, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)NCC(=O)NCC(=O)O)CCC(=O)O InChI=1S/C9H15N3O6/c10-5(1-2-7(14)15)9(18)12-3-6(13)11-4-8(16)17/h5H,1-4,10H2,(H,11,13)(H,12,18)(H,14,15)(H,16,17)/t5-/m0/s1 InChIKey: OAGVHWYIBZMWLA-YFKPBYRVSA-N |
| Database reference: |
| ChemSpider: ID 8097053 PubChem: ID 9921418 |