BIOPEP-UWM: Report
| ID | 122 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 25 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 728.8401 | Monoisotopic mass | 728.4071 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Nosho Y., Otagiri K., Okai H., Fukui S. | |
| Title | |
| Bitterness of diastereomers of a hexapeptide (Arg-Arg-Pro-Pro-Phe-Phe) containing D-phenylalanine in place of L-phenylalanine. Agric. Biol. Chem., 50, 1785-1790 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C33H52N12O7/c34-21(10-4-14-39-32(35)36)27(47)43-22(11-5-15-40-33(37)38)29(49)45-17-7-13-25(45)30(50)44-16-6-12-24(44)28(48)41-19-26(46)42-23(31(51)52)18-20-8-2-1-3-9-20/h1-3,8-9,21-25H,4-7,10-19,34H2,(H,41,48)(H,42,46)(H,43,47)(H,51,52)(H4,35,36,39)(H4,37,38,40)/t21-,22-,23-,24-,25-/m0/s1 InChIKey: WBTDEMSVGXIWOE-KEOOTSPTSA-N |
| Database reference: |