BIOPEP-UWM: Report
| ID | 126 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 12.5 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 727.8916 | Monoisotopic mass | 727.4368 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Miyake I., Ishibashi N., Fukui H., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. II. Syntheses of bitter peptide fragments and analogs of BPIa (Arg-Gly-Pro-Pro-Phe-Ile-Val) from casein hydrolysate. Bull. Chem. Soc. Jpn., 56, 1116-1119, 1983 | |
| Year | Source |
| 1983 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C36H57N9O7/c1-5-22(4)29(32(48)42-28(21(2)3)35(51)52)43-30(46)25(20-23-12-7-6-8-13-23)41-31(47)26-15-10-18-44(26)34(50)27-16-11-19-45(27)33(49)24(37)14-9-17-40-36(38)39/h6-8,12-13,21-22,24-29H,5,9-11,14-20,37H2,1-4H3,(H,41,47)(H,42,48)(H,43,46)(H,51,52)(H4,38,39,40)/t22-,24-,25-,26-,27-,28-,29-/m0/s1 InChIKey: YSRSHWZPNAIHPQ-XMKWUEEFSA-N |
| Database reference: |