BIOPEP-UWM: Report
| ID | 130 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.48 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 628.7576 | Monoisotopic mass | 628.3573 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shigenaga T., Otagiri K., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolysate. VII. Bitterness of the retro-BPIa (Val-Ile-Phe-Pro-Pro-Gly-Arg) and its fragments. Bull. Chem. Soc. Jpn., 57, 103-107 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(=O)NCC(=O)O)CCC2)CCC1)Cc1ccccc1)[C@H](CC)C)C(C)C InChI=1S/C32H48N6O7/c1-5-20(4)27(36-29(42)26(33)19(2)3)30(43)35-22(17-21-11-7-6-8-12-21)31(44)38-16-10-14-24(38)32(45)37-15-9-13-23(37)28(41)34-18-25(39)40/h6-8,11-12,19-20,22-24,26-27H,5,9-10,13-18,33H2,1-4H3,(H,34,41)(H,35,43)(H,36,42)(H,39,40)/t20-,22-,23-,24-,26-,27-/m0/s1 InChIKey: SLYNXQSXODGESW-PQJTZWKESA-N |
| Database reference: |