BIOPEP-UWM: Report
| ID | 131 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.33 | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 260.2861 | Monoisotopic mass | 260.1367 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ohyama S., Ishibashi N., Tamura M., Nishizaki H., Okai H. | |
| Title | |
| Synthesis of bitter peptides composed of aspartic acid and glutamic acid. Agric. Biol. Chem., 52, 871-872, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CC(C)C InChI=1S/C11H20N2O5/c1-6(2)5-7(12)10(16)13-8(11(17)18)3-4-9(14)15/h6-8H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/t7-,8-/m0/s1 InChIKey: NFNVDJGXRFEYTK-YUMQZZPRSA-N Another publication concerning peptide bitterness: Kuramitsu R., Takahashi M., Tahara K., Nakamura K., Okai H., 1996, Tastes produced by peptides containing ionic groups and by related compounds. Biosci., Biotech., Biochem., 60, 1637-1642 Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 5447 ChEBI: ID 74531 ChemSpider: ID 5373210 PubChem: ID 7009630 ZINC: ID ZINC02384848 |