BIOPEP-UWM: Report
| ID | 133 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 25 | |||
| Number of residues | 11 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1013.1476 | Monoisotopic mass | 1012.5438 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Miyake I., Kouge K., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. IX. Syntheses and bitter taste of bitter peptide BPIa dimer, (Arg–Gly–Pro–Pro–Phe–Ile–Val)2, and Gly–Gly BPIa derivatives. Bull. Chem. Soc. Jpn. 57, 1984, 8 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)O InChI=1S/C46H72N14O12/c1-5-27(4)39(44(71)57-38(26(2)3)43(70)53-22-34(62)52-25-37(65)66)58-41(68)30(20-28-12-7-6-8-13-28)56-42(69)31-15-10-19-60(31)45(72)32-16-11-18-59(32)36(64)24-54-40(67)29(14-9-17-50-46(48)49)55-35(63)23-51-33(61)21-47/h6-8,12-13,26-27,29-32,38-39H,5,9-11,14-25,47H2,1-4H3,(H,51,61)(H,52,62)(H,53,70)(H,54,67)(H,55,63)(H,56,69)(H,57,71)(H,58,68)(H,65,66)(H4,48,49,50)/t27-,29-,30-,31-,32-,38-,39-/m0/s1 InChIKey: PQXRVBPVVZCSNF-QNIZMUGTSA-N |
| Database reference: |