BIOPEP-UWM: Report
| ID | 135 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 1.3 | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 479.5683 | Monoisotopic mass | 479.2735 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Tada M., Okai H., Fukui S. | |
| Title | |
| Bitter taste of H-Pro-Phe-Pro-Gly-Pro-Ile-Pro-OH corresponding to the partial sequence (positions 61-67) of bovine beta-casein, and related peptides. Agric. Biol. Chem., 50, 1986, 1247-1254 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1[C@H](C(=O)NCC(=O)N2[C@H](C(=O)N[C@H](C(=O)N3[C@H](C(=O)O)CCC3)[C@H](CC)C)CCC2)CCC1 InChI=1S/C23H37N5O6/c1-3-14(2)19(22(32)28-12-6-9-17(28)23(33)34)26-21(31)16-8-5-11-27(16)18(29)13-25-20(30)15-7-4-10-24-15/h14-17,19,24H,3-13H2,1-2H3,(H,25,30)(H,26,31)(H,33,34)/t14-,15-,16-,17-,19-/m0/s1 InChIKey: NLQCZICWBCFVKK-WSRJKRBPSA-N |
| Database reference: |