BIOPEP-UWM: Report
| ID | 140 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 1.7 | |||
| Number of residues | 7 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 686.7573 | Monoisotopic mass | 686.3490 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Shigenaga T., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. IV. Relationship between bitterness and hydrophobic amino acids moiety in the C-Terminal of BPIa (Arg–Gly–Pro–Pro–Phe–Ile–Val). Bull. Chem. Soc. Jpn., 57, 90-96 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NCC(=O)O InChI=1S/C31H46N10O8/c32-20(9-4-12-35-31(33)34)27(46)38-17-25(43)40-13-6-11-23(40)30(49)41-14-5-10-22(41)29(48)39-21(15-19-7-2-1-3-8-19)28(47)37-16-24(42)36-18-26(44)45/h1-3,7-8,20-23H,4-6,9-18,32H2,(H,36,42)(H,37,47)(H,38,46)(H,39,48)(H,44,45)(H4,33,34,35)/t20-,21-,22+,23+/m0/s1 InChIKey: UZCRORAHXPHWRZ-MYDTUXCISA-N |
| Database reference: |