BIOPEP-UWM: Report
| ID | 143 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 17.0 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 719.8284 | Monoisotopic mass | 719.3744 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Shigenaga T., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. IV. Relationship between bitterness and hydrophobic amino acids moiety in the C-Terminal of BPIa (Arg–Gly–Pro–Pro–Phe–Ile–Val). Bull. Chem. Soc. Jpn., 57, 90-96 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C36H49N9O7/c37-25(14-7-17-40-36(38)39)31(47)41-22-30(46)44-18-9-16-29(44)34(50)45-19-8-15-28(45)33(49)42-26(20-23-10-3-1-4-11-23)32(48)43-27(35(51)52)21-24-12-5-2-6-13-24/h1-6,10-13,25-29H,7-9,14-22,37H2,(H,41,47)(H,42,49)(H,43,48)(H,51,52)(H4,38,39,40)/t25-,26-,27-,28+,29+/m0/s1 InChIKey: ZEYVQJMJIUZTEC-OTJWULCMSA-N |
| Database reference: |