BIOPEP-UWM: Report
| ID | 147 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 9.0 | |||
| Number of residues | 9 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 890.9820 | Monoisotopic mass | 890.4386 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Shigenaga T., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. IV. Relationship between bitterness and hydrophobic amino acids moiety in the C-Terminal of BPIa (Arg–Gly–Pro–Pro–Phe–Ile–Val). Bull. Chem. Soc. Jpn., 57, 90-96 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C42H58N12O10/c43-28(14-7-17-46-42(44)45)37(59)50-25-36(58)53-18-9-16-32(53)40(62)54-19-8-15-31(54)39(61)49-23-34(56)47-22-33(55)48-24-35(57)51-29(20-26-10-3-1-4-11-26)38(60)52-30(41(63)64)21-27-12-5-2-6-13-27/h1-6,10-13,28-32H,7-9,14-25,43H2,(H,47,56)(H,48,55)(H,49,61)(H,50,59)(H,51,57)(H,52,60)(H,63,64)(H4,44,45,46)/t28-,29-,30-,31+,32+/m0/s1 InChIKey: ZBRWVYIGICTCRV-WTOCPUKLSA-N |
| Database reference: |