BIOPEP-UWM: Report
| ID | 148 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 100 | |||
| Number of residues | 7 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 867.0019 | Monoisotopic mass | 866.4426 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Shigenaga T., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. IV. Relationship between bitterness and hydrophobic amino acids moiety in the C-Terminal of BPIa (Arg–Gly–Pro–Pro–Phe–Ile–Val). Bull. Chem. Soc. Jpn., 57, 90-96 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C45H58N10O8/c46-32(19-10-22-49-45(47)48)39(57)50-28-38(56)54-23-12-21-37(54)43(61)55-24-11-20-36(55)42(60)52-34(26-30-15-6-2-7-16-30)40(58)51-33(25-29-13-4-1-5-14-29)41(59)53-35(44(62)63)27-31-17-8-3-9-18-31/h1-9,13-18,32-37H,10-12,19-28,46H2,(H,50,57)(H,51,58)(H,52,60)(H,53,59)(H,62,63)(H4,47,48,49)/t32-,33-,34-,35-,36+,37+/m0/s1 InChIKey: XAJZJSBBOGTKCO-WOKAEJKNSA-N |
| Database reference: |