BIOPEP-UWM: Report
| ID | 152 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 2.6 | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 475.5400 | Monoisotopic mass | 475.2536 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nosho Y., Otagiri K., Shinoda I., Okai H. | |
| Title | |
| Studies on a model of bitter peptides including arginine, proline and phenylalanine residues. II. Bitterness behavior of a tetrapeptide (Arg-Pro-Phe-Phe) and its derivatives. Agric. Biol. Chem., 49, 1829-1837 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)O InChI=1S/C22H33N7O5/c23-15(8-4-10-26-22(24)25)21(34)29-11-5-9-17(29)20(33)28-16(19(32)27-13-18(30)31)12-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13,23H2,(H,27,32)(H,28,33)(H,30,31)(H4,24,25,26)/t15-,16-,17+/m0/s1 InChIKey: BHOBJYSKDMBWLG-YESZJQIVSA-N |
| Database reference: |