BIOPEP-UWM: Report
| ID | 154 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.2 | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 622.7135 | Monoisotopic mass | 622.3218 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nosho Y., Otagiri K., Shinoda I., Okai H. | |
| Title | |
| Studies on a model of bitter peptides including arginine, proline and phenylalanine residues. II. Bitterness behavior of a tetrapeptide (Arg-Pro-Phe-Phe) and its derivatives. Agric. Biol. Chem., 49, 1829-1837 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C31H42N8O6/c32-22(13-7-15-35-31(33)34)29(43)39-16-8-14-25(39)28(42)36-19-26(40)37-23(17-20-9-3-1-4-10-20)27(41)38-24(30(44)45)18-21-11-5-2-6-12-21/h1-6,9-12,22-25H,7-8,13-19,32H2,(H,36,42)(H,37,40)(H,38,41)(H,44,45)(H4,33,34,35)/t22-,23-,24-,25+/m0/s1 InChIKey: LQQNYBBJPIBEEH-OJJQZRKESA-N |
| Database reference: |