BIOPEP-UWM: Report
| ID | 156 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 143 | |||
| Number of residues | 10 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1407.6564 | Monoisotopic mass | 1406.7267 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nosho Y., Otagiri K., Shinoda I., Okai H. | |
| Title | |
| Studies on a model of bitter peptides including arginine, proline and phenylalanine residues. II. Bitterness behavior of a tetrapeptide (Arg-Pro-Phe-Phe) and its derivatives. Agric. Biol. Chem., 49, 1829-1837 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C76H94N16O11/c77-55(43-49-23-7-1-8-24-49)65(93)86-58(44-50-25-9-2-10-26-50)66(94)84-56(35-19-39-82-75(78)79)72(100)91-41-21-37-63(91)70(98)88-60(46-52-29-13-4-14-30-52)68(96)87-59(45-51-27-11-3-12-28-51)67(95)85-57(36-20-40-83-76(80)81)73(101)92-42-22-38-64(92)71(99)89-61(47-53-31-15-5-16-32-53)69(97)90-62(74(102)103)48-54-33-17-6-18-34-54/h1-18,23-34,55-64H,19-22,35-48,77H2,(H,84,94)(H,85,95)(H,86,93)(H,87,96)(H,88,98)(H,89,99)(H,90,97)(H,102,103)(H4,78,79,82)(H4,80,81,83)/t55-,56-,57-,58-,59-,60-,61-,62-,63+,64+/m0/s1 InChIKey: MSYJMWGGOUIFRN-PXIKEFDQSA-N |
| Database reference: |