BIOPEP-UWM: Report
| ID | 159 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 12.5 | |||
| Number of residues | 9 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 899.0452 | Monoisotopic mass | 898.5010 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Miyake I., Kouge K., Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzate. IX. Syntheses and bitter taste of bitter peptide BPIa dimer, (Arg–Gly–Pro–Pro–Phe–Ile–Val)2, and Gly–Gly BPIa derivatives. Bull. Chem. Soc. Jpn. 57, 815-818 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C42H66N12O10/c1-5-25(4)35(39(61)51-34(24(2)3)41(63)64)52-37(59)28(20-26-12-7-6-8-13-26)50-38(60)29-15-10-19-54(29)40(62)30-16-11-18-53(30)33(57)23-48-36(58)27(14-9-17-46-42(44)45)49-32(56)22-47-31(55)21-43/h6-8,12-13,24-25,27-30,34-35H,5,9-11,14-23,43H2,1-4H3,(H,47,55)(H,48,58)(H,49,56)(H,50,60)(H,51,61)(H,52,59)(H,63,64)(H4,44,45,46)/t25-,27-,28-,29+,30+,34-,35-/m0/s1 InChIKey: NYGBOBXCCYIHBO-DZRPYAOQSA-N |
| Database reference: |