BIOPEP-UWM: Report
| ID | 16 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.01 | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 231.2516 | Monoisotopic mass | 231.1328 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
BIOPEP-UWM database of sensory peptides and amino acids SMILES: C(C[C@@H](C(=O)O)NC(=O)CN)CNC(=N)N InChI=1S/C8H17N5O3/c9-4-6(14)13-5(7(15)16)2-1-3-12-8(10)11/h5H,1-4,9H2,(H,13,14)(H,15,16)(H4,10,11,12)/t5-/m0/s1 InChIKey: JLXVRFDTDUGQEE-YFKPBYRVSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides, the ChEMBL database, the EROP-Moscow database; the PubChem database |
| Database reference: |
ACToR: ID 18635-55-7 AHTPDB: ID 1427; 3000; 3042; 3085; 3114; 3236; 3491; 3807; 3933; 4416; 4513; 4668; 5152; 5421; 5434; 6109; 6589 BindingDB: ID 50407457 BioPepDB: ID biopep00409 BIOPEP-UWM database of bioactive peptides: ID 7603 BRENDA: Ligand Gly-Arg ChEBI: ID 73860 ChEMBL: ID CHEMBL96806 ChemSpider: ID 4932140 EROP-Moscow: ID E10383 J-GLOBAL: ID 200907022189681376 Metabolights: ID MTBLC73860 Nikkaji: ID J1.481.855C PubChem: CID 6426706 SATPdb: ID satpdb16592 SureChEMBL: ID SCHEMBL187696 ZINC: ID ZINC01576211 |