BIOPEP-UWM: Report
| ID | 164 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.22 | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 188.2236 | Monoisotopic mass | 188.1157 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Kouge K., Shinoda I., Kanehisa H., Okai H. | |
| Title | |
| A mechanism for bitter taste sensibility in peptides. Agric. Biol. Chem., 52, 819-827, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@H](C(=O)NCC(=O)O)[C@H](CC)C InChI=1S/C8H16N2O3/c1-3-5(2)7(9)8(13)10-4-6(11)12/h5,7H,3-4,9H2,1-2H3,(H,10,13)(H,11,12)/t5-,7-/m0/s1 InChIKey: UCGDDTHMMVWVMV-FSPLSTOPSA-N Another references concerning bitterness: Asao M., Iwamura H., Akamatsu M., Fujita T., 1987, Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879 Collantes E. R., Dunn W. J., 1995, Amino acid side chain descriptors for quantitative structure-activity relationship studies of peptide analogues. J. Med. Chem., 38, 2705-2713 Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 7595); the ChEMBL database; the EROP-Moscow database; the PubChem database |
| Database reference: |
| AHTPDB: ID 1478; 1683; 3020; 3107; 3109; 3564; 3799; 3857; 3950; 4426; 4505; 6581 BindingDB: ID 50407434 BioPepDB: ID biopep00511 BIOPEP-UWM database of bioactive peptides: ID 7595 ChEBI: ID 74066 ChEMBL: ID CHEMBL301979 ChemSpider: ID 5360987 EROP-Moscow: ID E10391 FeptideDB: ID 7595 J-GLOBAL: ID 200907055232808135 Metabolights: ID MTBLC133641 Metabolomics Workbench: ID 71880 Nikkaji: ID J265.924G PubChem: ID 6992869 SATPdb: ID satpdb14233 SureChEMBL: ID SCHEMBL8728266 ZINC: ID ZINC000001590840 |