BIOPEP-UWM: Report
| ID | 167 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 64 | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 807.9777 | Monoisotopic mass | 807.4952 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakatani M., Nakata T., Kouge K., Okai H. | |
| Title | |
| Studies on bitter peptides from casein hydrolyzate. XIV. Bitter taste of synthetic analogs of octapeptide, Arg–Gly–Pro–Phe–Pro–Ile–Ile–Val, corresponding to the C-terminal portion of beta-casein. Bull. Chem. | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C37H65N11O9/c1-7-21(5)29(35(55)46-30(22(6)8-2)34(54)44-28(20(3)4)36(56)57)45-33(53)25-14-11-17-48(25)27(50)19-43-32(52)24-13-10-16-47(24)26(49)18-42-31(51)23(38)12-9-15-41-37(39)40/h20-25,28-30H,7-19,38H2,1-6H3,(H,42,51)(H,43,52)(H,44,54)(H,45,53)(H,46,55)(H,56,57)(H4,39,40,41)/t21-,22-,23-,24+,25+,28-,29-,30-/m0/s1 InChIKey: IJQSCRJGAZXRMT-KPKCCQBYSA-N |
| Database reference: |