BIOPEP-UWM: Report
| ID | 168 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 20 | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 898.1000 | Monoisotopic mass | 897.5420 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakatani M., Nakata T., Kouge K., Okai H. | |
| Title | |
| Studies on bitter peptides from casein hydrolyzate. XIV. Bitter taste of synthetic analogs of octapeptide, Arg–Gly–Pro–Phe–Pro–Ile–Ile–Val, corresponding to the C-terminal portion of beta-casein. Bull. Chem. | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C44H71N11O9/c1-7-26(5)35(41(61)53-36(27(6)8-2)40(60)51-34(25(3)4)43(63)64)52-38(58)30(23-28-15-10-9-11-16-28)50-39(59)31-18-13-22-55(31)42(62)32-19-14-21-54(32)33(56)24-49-37(57)29(45)17-12-20-48-44(46)47/h9-11,15-16,25-27,29-32,34-36H,7-8,12-14,17-24,45H2,1-6H3,(H,49,57)(H,50,59)(H,51,60)(H,52,58)(H,53,61)(H,63,64)(H4,46,47,48)/t26-,27-,29-,30-,31+,32+,34-,35-,36-/m0/s1 InChIKey: KNORNTOKIFPKLQ-OGTKHFNDSA-N |
| Database reference: |