BIOPEP-UWM: Report
| ID | 169 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 6.67 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 699.8782 | Monoisotopic mass | 699.4306 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzates. V. Bitterness of the sytnthetic N-terminal analogs of des-Gly2-BPIa (Arg-Pro-Pro-Phe-Ile-Val). Bull. Chem. Soc. Jpn., 57, 301-302 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)[C@H](CC)C)Cc3ccccc3)CCC2)CCC1)CCCCN InChI=1S/C36H57N7O7/c1-5-23(4)30(33(46)40-29(22(2)3)36(49)50)41-31(44)26(21-24-13-7-6-8-14-24)39-32(45)27-16-11-19-42(27)35(48)28-17-12-20-43(28)34(47)25(38)15-9-10-18-37/h6-8,13-14,22-23,25-30H,5,9-12,15-21,37-38H2,1-4H3,(H,39,45)(H,40,46)(H,41,44)(H,49,50)/t23-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey: RNVNPSGYAULBRK-VLZLLJQKSA-N |
| Database reference: |