BIOPEP-UWM: Report
| ID | 170 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.33 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 718.8799 | Monoisotopic mass | 718.4041 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kanehisa H., Okai H. | |
| Title | |
| Studies of bitter peptides from casein hydrolyzates. V. Bitterness of the sytnthetic N-terminal analogs of des-Gly2-BPIa (Arg-Pro-Pro-Phe-Ile-Val). Bull. Chem. Soc. Jpn., 57, 301-302 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)[C@H](CC)C)Cc3ccccc3)CCC2)CCC1)Cc1ccccc1 InChI=1S/C39H54N6O7/c1-5-25(4)33(36(48)42-32(24(2)3)39(51)52)43-34(46)29(23-27-16-10-7-11-17-27)41-35(47)30-18-12-20-44(30)38(50)31-19-13-21-45(31)37(49)28(40)22-26-14-8-6-9-15-26/h6-11,14-17,24-25,28-33H,5,12-13,18-23,40H2,1-4H3,(H,41,47)(H,42,48)(H,43,46)(H,51,52)/t25-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey: UWTOFOHNJAGKFC-GCNYMACQSA-N |
| Database reference: |