BIOPEP-UWM: Report
| ID | 171 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.7 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 325.4022 | Monoisotopic mass | 325.1995 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Tada M., Okai H., Fukui S. | |
| Title | |
| Bitter taste of H-Pro-Phe-Pro-Gly-Pro-Ile-Pro-OH corresponding to the partial sequence (positions 61~67) of bovine beta-casein, and related peptides. Agric. Biol. Chem., 50, 1247-1254 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)O)CCC2)[C@H](CC)C)CCC1 InChI=1S/C16H27N3O4/c1-3-10(2)13(18-14(20)11-6-4-8-17-11)15(21)19-9-5-7-12(19)16(22)23/h10-13,17H,3-9H2,1-2H3,(H,18,20)(H,22,23)/t10-,11-,12-,13-/m0/s1 InChIKey: FKVNLUZHSFCNGY-CYDGBPFRSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 4590; 4843; 5504 |