BIOPEP-UWM: Report
| ID | 172 |
| Name | bitter amino acid |
| sequence |
| Function: | |||
| (Rcaf) 0.05 | |||
| Number of residues | 1 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 131.1724 | Monoisotopic mass | 131.0943 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Arita Y., Kanehisa H., Kouge K., Okai H., Fukui S. | |
| Title | |
| Bitterness of leucine-containing peptides. Agric. Biol. Chem., 51, 2389-2394, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: CC(C)C[C@H](N)C(O)=O InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 InChIKey: ROHFNLRQFUQHCH-YFKPBYRVSA-N First reference concerning bitterness: Solms J., Vuataz L., Egli R. H., 1965, The taste of L- and D-amino acids. Experientia, XXI, 692-694 |
| Database reference: |
| BindingDB: ID 50219348 BRENDA: Ligand Leu ChEBI: ID 15603 ChEMBL: ID CHEMBL291962 ChemIDplus: ID 000061905 ChemSpider: ID 5880 DrugBank: ID DB00149 Golm Metabolome Database (GMD): Compound L-Leucine Human Metabolome Database (HMDB): ID HMDB00687 JECFA: Compound L-Leucine KEGG: ID C00123 PubChem: ID 6106 ZINC: ID ZINC03645145 |