BIOPEP-UWM: Report
| ID | 192 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 32 | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 880.0402 | Monoisotopic mass | 879.5162 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakatani M., Nakata T., Kouge K., Okai H. | |
| Title | |
| Studies on bitter peptides from casein hydrolyzate. XIV. Bitter taste of synthetic analogs of octapeptide, Arg–Gly–Pro–Phe–Pro–Ile–Ile–Val, corresponding to the C-terminal portion of beta-casein. Bull. Chem. | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C40H69N11O11/c1-7-22(5)31(37(59)49-32(23(6)8-2)36(58)47-30(21(3)4)39(61)62)48-35(57)27-14-11-19-51(27)38(60)25(15-16-29(53)54)46-34(56)26-13-10-18-50(26)28(52)20-45-33(55)24(41)12-9-17-44-40(42)43/h21-27,30-32H,7-20,41H2,1-6H3,(H,45,55)(H,46,56)(H,47,58)(H,48,57)(H,49,59)(H,53,54)(H,61,62)(H4,42,43,44)/t22-,23-,24-,25-,26+,27+,30-,31-,32-/m0/s1 InChIKey: GJDOUWIENNYYBU-XAOCSACCSA-N |
| Database reference: |